C19H19N5OS — CID 120656744
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)methanone (PubChem CID 120656744) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 120656744 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)methanone |
| SMILES | O=C(c1nc(-c2cccs2)n(-c2ccccc2)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C19H19N5OS/c25-19(23-11-13-9-20-10-14(13)12-23)17-21-18(16-7-4-8-26-16)24(22-17)15-5-2-1-3-6-15/h1-8,13-14,20H,9-12H2/t13-,14+ |
| InChIKey | MZHSVGWJUPHCRS-OKILXGFUSA-N |
| XLogP | 2.29 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |