C14H11N3O2S — CID 13411643
methyl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 13411643) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is methyl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 13411643 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1nc(-c2cccs2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H11N3O2S/c1-19-14(18)12-15-13(11-8-5-9-20-11)17(16-12)10-6-3-2-4-7-10/h2-9H,1H3 |
| InChIKey | MDOQIOIAIMRDEV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |