C25H25N5O3S — CID 46509447
[2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 46509447) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 46509447 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)COC(=O)c1nc(-c2cccs2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H25N5O3S/c1-28(2)19-13-11-18(12-14-19)16-29(3)22(31)17-33-25(32)23-26-24(21-10-7-15-34-21)30(27-23)20-8-5-4-6-9-20/h4-15H,16-17H2,1-3H3 |
| InChIKey | BCVMBHBLCMBXCR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|