C22H20N6O2S — CID 55505843
N'-[2-(4-methylanilino)acetyl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide (PubChem CID 55505843) has the molecular formula C22H20N6O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is N'-[2-(4-methylanilino)acetyl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide.
| Compound Name | N'-[2-(4-methylanilino)acetyl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55505843 |
| Molecular Formula | C22H20N6O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N'-[2-(4-methylanilino)acetyl]-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2nc(-c3cccs3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H20N6O2S/c1-15-9-11-16(12-10-15)23-14-19(29)25-26-22(30)20-24-21(18-8-5-13-31-18)28(27-20)17-6-3-2-4-7-17/h2-13,23H,14H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | PCPYLFRDCUFSHI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|