C19H18N6O3S — CID 102556248
N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 102556248) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 102556248 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-1-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)c2nc(-c3cccs3)n(-c3ccccc3)n2)C1=O |
| InChI | InChI=1S/C19H18N6O3S/c1-3-19(2)17(27)25(18(28)21-19)23-16(26)14-20-15(13-10-7-11-29-13)24(22-14)12-8-5-4-6-9-12/h4-11H,3H2,1-2H3,(H,21,28)(H,23,26) |
| InChIKey | RHLZURVXMXEDRN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|