C19H25NO3S — CID 60560710
N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 60560710) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 60560710 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | C=CCN(C(=O)Cc1ccc2c(c1)CCCC2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H25NO3S/c1-2-10-20(18-9-11-24(22,23)14-18)19(21)13-15-7-8-16-5-3-4-6-17(16)12-15/h2,7-8,12,18H,1,3-6,9-11,13-14H2 |
| InChIKey | GABVWBFVQZAVFE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|