C13H22N2O4S — CID 120789394
(2S,5R)-5-(aminomethyl)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyloxolane-2-carboxamide (PubChem CID 120789394) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyloxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 120789394 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(1,1-dioxothiolan-3-yl)-N-prop-2-enyloxolane-2-carboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1CC[C@H](CN)O1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O4S/c1-2-6-15(10-5-7-20(17,18)9-10)13(16)12-4-3-11(8-14)19-12/h2,10-12H,1,3-9,14H2/t10?,11-,12+/m1/s1 |
| InChIKey | RGSUMEJZHMQNQC-SAIIYOCFSA-N |
| XLogP | -0.31 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|