C26H36N2O4S — CID 18879880
3-butoxy-N-[[4-(diethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 18879880) has the molecular formula C26H36N2O4S and a molecular weight of 472.65 g/mol. Its IUPAC name is 3-butoxy-N-[[4-(diethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-butoxy-N-[[4-(diethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 18879880 |
| Molecular Formula | C26H36N2O4S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 3-butoxy-N-[[4-(diethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(Cc2ccc(N(CC)CC)cc2)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C26H36N2O4S/c1-4-7-16-32-25-10-8-9-22(18-25)26(29)28(24-15-17-33(30,31)20-24)19-21-11-13-23(14-12-21)27(5-2)6-3/h8-14,18,24H,4-7,15-17,19-20H2,1-3H3 |
| InChIKey | LGHBOIGNVUWMNH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|