C19H28N2O5S — CID 108510571
N'-(1,1-dioxothiolan-3-yl)-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-N'-ethyloxamide (PubChem CID 108510571) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-N'-ethyloxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-N'-ethyloxamide |
|---|---|
| PubChem CID | 108510571 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-[1-(2-ethoxy-5-methylphenyl)ethyl]-N'-ethyloxamide |
| SMILES | CCOc1ccc(C)cc1C(C)NC(=O)C(=O)N(CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H28N2O5S/c1-5-21(15-9-10-27(24,25)12-15)19(23)18(22)20-14(4)16-11-13(3)7-8-17(16)26-6-2/h7-8,11,14-15H,5-6,9-10,12H2,1-4H3,(H,20,22) |
| InChIKey | JIGRWOZKIWKAQT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|