C14H19BrN2O3S — CID 108898907
3-[(3-bromophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-1-ethylurea (PubChem CID 108898907) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-1-ethylurea.
| Compound Name | 3-[(3-bromophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-1-ethylurea |
|---|---|
| PubChem CID | 108898907 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-1-ethylurea |
| SMILES | CCN(C(=O)NCc1cccc(Br)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19BrN2O3S/c1-2-17(13-6-7-21(19,20)10-13)14(18)16-9-11-4-3-5-12(15)8-11/h3-5,8,13H,2,6-7,9-10H2,1H3,(H,16,18) |
| InChIKey | HNOYVWAWLISMQX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |