C11H20ClNO4S — CID 62727218
3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-2-methylpropanamide (PubChem CID 62727218) has the molecular formula C11H20ClNO4S and a molecular weight of 297.80 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-2-methylpropanamide.
| Compound Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62727218 |
| Molecular Formula | C11H20ClNO4S |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-2-methylpropanamide |
| SMILES | COCCN(C(=O)C(C)CCl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20ClNO4S/c1-9(7-12)11(14)13(4-5-17-2)10-3-6-18(15,16)8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | AAQZUQFBVXZUBB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|