C14H25NO5S — CID 96999212
(2S)-2-but-3-enoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 96999212) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is (2S)-2-but-3-enoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-but-3-enoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 96999212 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2S)-2-but-3-enoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | C=CCCO[C@@H](C)C(=O)N(CCOC)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H25NO5S/c1-4-5-8-20-12(2)14(16)15(7-9-19-3)13-6-10-21(17,18)11-13/h4,12-13H,1,5-11H2,2-3H3/t12-,13+/m0/s1 |
| InChIKey | NAPNAMDSZULNGK-QWHCGFSZSA-N |
| XLogP | 0.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|