C14H23NO3S — CID 95266358
(1R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-propylcyclohex-3-ene-1-carboxamide (PubChem CID 95266358) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is (1R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-propylcyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-propylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95266358 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (1R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-propylcyclohex-3-ene-1-carboxamide |
| SMILES | CCCN(C(=O)[C@H]1CC=CCC1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H23NO3S/c1-2-9-15(13-8-10-19(17,18)11-13)14(16)12-6-4-3-5-7-12/h3-4,12-13H,2,5-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | ONTUYIDPNAYYDF-STQMWFEESA-N |
| XLogP | 1.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|