C19H27ClN2O6S2 — CID 55483224
N-butyl-2-chloro-N-(1,1-dioxothiolan-3-yl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55483224) has the molecular formula C19H27ClN2O6S2 and a molecular weight of 479.02 g/mol. Its IUPAC name is N-butyl-2-chloro-N-(1,1-dioxothiolan-3-yl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-butyl-2-chloro-N-(1,1-dioxothiolan-3-yl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55483224 |
| Molecular Formula | C19H27ClN2O6S2 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-butyl-2-chloro-N-(1,1-dioxothiolan-3-yl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCCCN(C(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H27ClN2O6S2/c1-2-3-7-22(15-6-12-29(24,25)14-15)19(23)17-13-16(4-5-18(17)20)30(26,27)21-8-10-28-11-9-21/h4-5,13,15H,2-3,6-12,14H2,1H3 |
| InChIKey | BMYUVUZHZGSLJJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |