C19H24N2O3S — CID 78786626
N-cyclohexyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-N-methylacetamide (PubChem CID 78786626) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 78786626 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-cyclohexyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-N-methylacetamide |
| SMILES | CN(C(=O)CSCCN1C(=O)c2ccccc2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C19H24N2O3S/c1-20(14-7-3-2-4-8-14)17(22)13-25-12-11-21-18(23)15-9-5-6-10-16(15)19(21)24/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3 |
| InChIKey | KZPXUAYKYRAAGD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|