C23H24N2O4 — CID 51268360
N-cyclopentyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-methylbenzamide (PubChem CID 51268360) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-cyclopentyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-methylbenzamide.
| Compound Name | N-cyclopentyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 51268360 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-cyclopentyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-methylbenzamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)N(C)C1CCCC1 |
| InChI | InChI=1S/C23H24N2O4/c1-24(16-7-3-4-8-16)21(26)19-13-15(11-12-20(19)29-2)14-25-22(27)17-9-5-6-10-18(17)23(25)28/h5-6,9-13,16H,3-4,7-8,14H2,1-2H3 |
| InChIKey | SZTWWGMMMOXCTH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|