C24H24N2O7 — CID 2667928
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate (PubChem CID 2667928) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 2667928 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OCC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C24H24N2O7/c1-31-20-9-8-15(13-26-22(28)17-6-2-3-7-18(17)23(26)29)11-19(20)24(30)33-14-21(27)25-12-16-5-4-10-32-16/h2-3,6-9,11,16H,4-5,10,12-14H2,1H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | HHGFPPYRFXFXBC-MRXNPFEDSA-N |
| XLogP | 1.94 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|