C23H24N2O5 — CID 27660661
2-[[3-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione (PubChem CID 27660661) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[[3-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 27660661 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[[3-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C23H24N2O5/c1-14-11-24(12-15(2)30-14)21(26)19-10-16(8-9-20(19)29-3)13-25-22(27)17-6-4-5-7-18(17)23(25)28/h4-10,14-15H,11-13H2,1-3H3/t14-,15+ |
| InChIKey | WHAUYTNONWOJPX-GASCZTMLSA-N |
| XLogP | 2.74 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|