C28H26N2O5 — CID 55388015
N-cyclopropyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 55388015) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-cyclopropyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | N-cyclopropyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55388015 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-cyclopropyl-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CN(C(=O)c2cc(CN3C(=O)c4ccccc4C3=O)ccc2OC)C2CC2)cc1 |
| InChI | InChI=1S/C28H26N2O5/c1-34-21-12-7-18(8-13-21)16-29(20-10-11-20)28(33)24-15-19(9-14-25(24)35-2)17-30-26(31)22-5-3-4-6-23(22)27(30)32/h3-9,12-15,20H,10-11,16-17H2,1-2H3 |
| InChIKey | XJGHXRVSOPVIKM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|