C22H22N2O4 — CID 51206691
N-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 51206691) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | N-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 51206691 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-14(24-21(26)18-5-3-4-6-19(18)22(24)27)20(25)23(16-9-10-16)13-15-7-11-17(28-2)12-8-15/h3-8,11-12,14,16H,9-10,13H2,1-2H3 |
| InChIKey | LAOJPPRZJXTVAR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|