C25H20F2N2O5S — CID 16591431
[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 16591431) has the molecular formula C25H20F2N2O5S and a molecular weight of 498.51 g/mol. Its IUPAC name is [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 16591431 |
| Molecular Formula | C25H20F2N2O5S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | O=C(COC(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C25H20F2N2O5S/c26-25(27)35-19-11-2-1-10-18(19)28-20(30)14-34-21(31)12-5-13-29-23(32)16-8-3-6-15-7-4-9-17(22(15)16)24(29)33/h1-4,6-11,25H,5,12-14H2,(H,28,30) |
| InChIKey | RKHCMMAAFTWUAY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|