C26H23FN2O7S — CID 2576803
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2576803) has the molecular formula C26H23FN2O7S and a molecular weight of 526.54 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2576803 |
| Molecular Formula | C26H23FN2O7S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)[C@@H]3CS[C@@]4(c5ccc(F)cc5)CCC(=O)N34)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H23FN2O7S/c1-2-34-25(33)28-18-7-8-19-15(11-23(31)36-21(19)12-18)13-35-24(32)20-14-37-26(10-9-22(30)29(20)26)16-3-5-17(27)6-4-16/h3-8,11-12,20H,2,9-10,13-14H2,1H3,(H,28,33)/t20-,26+/m0/s1 |
| InChIKey | BFMLRVGNEUSDQD-RXFWQSSRSA-N |
| XLogP | 4.13 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|