C20H21NO6S — CID 7822993
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822993) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822993 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCc1cc2c(COC(=O)[C@@H]3CS[C@@]4(C)CCC(=O)N34)cc(=O)oc2cc1O |
| InChI | InChI=1S/C20H21NO6S/c1-3-11-6-13-12(7-18(24)27-16(13)8-15(11)22)9-26-19(25)14-10-28-20(2)5-4-17(23)21(14)20/h6-8,14,22H,3-5,9-10H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | YJHKBHCCUQODAI-XOBRGWDASA-N |
| XLogP | 2.56 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|