C21H17NO7 — CID 16512081
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-nitrophenoxy)acetate (PubChem CID 16512081) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-nitrophenoxy)acetate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 16512081 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-nitrophenoxy)acetate |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C21H17NO7/c23-20-10-15(18-8-13-2-1-3-14(13)9-19(18)29-20)11-28-21(24)12-27-17-6-4-16(5-7-17)22(25)26/h4-10H,1-3,11-12H2 |
| InChIKey | UZDZHQUMFGBKFC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|