C26H21NO4 — CID 16521546
2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methoxy]-N-phenylbenzamide (PubChem CID 16521546) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methoxy]-N-phenylbenzamide.
| Compound Name | 2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 16521546 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methoxy]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C26H21NO4/c28-25-15-19(22-13-17-7-6-8-18(17)14-24(22)31-25)16-30-23-12-5-4-11-21(23)26(29)27-20-9-2-1-3-10-20/h1-5,9-15H,6-8,16H2,(H,27,29) |
| InChIKey | IMFCPPGQSGTJRI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|