C19H18Cl3N3O4S — CID 25498510
4-chloro-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 25498510) has the molecular formula C19H18Cl3N3O4S and a molecular weight of 490.80 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 25498510 |
| Molecular Formula | C19H18Cl3N3O4S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | 4-chloro-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H18Cl3N3O4S/c20-13-4-6-14(21)16(10-13)24-18(26)11-23-19(27)12-3-5-15(22)17(9-12)30(28,29)25-7-1-2-8-25/h3-6,9-10H,1-2,7-8,11H2,(H,23,27)(H,24,26) |
| InChIKey | OKSHRJUIDPVJPI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |