C27H28N6O5S2 — CID 21170917
2-morpholin-4-yl-5-nitro-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 21170917) has the molecular formula C27H28N6O5S2 and a molecular weight of 580.69 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-nitro-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-morpholin-4-yl-5-nitro-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21170917 |
| Molecular Formula | C27H28N6O5S2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-morpholin-4-yl-5-nitro-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)cc1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H28N6O5S2/c34-25(22-18-21(33(36)37)7-8-23(22)31-13-15-38-16-14-31)29-27(39)28-19-3-5-20(6-4-19)30-9-11-32(12-10-30)26(35)24-2-1-17-40-24/h1-8,17-18H,9-16H2,(H2,28,29,34,39) |
| InChIKey | CFOOVFSUSLMUMQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|