C28H26N4O3S2 — CID 17317934
3-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 17317934) has the molecular formula C28H26N4O3S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is 3-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17317934 |
| Molecular Formula | C28H26N4O3S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 3-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NC(=S)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C28H26N4O3S2/c1-35-24-18-20-6-3-2-5-19(20)17-23(24)26(33)30-28(36)29-21-8-10-22(11-9-21)31-12-14-32(15-13-31)27(34)25-7-4-16-37-25/h2-11,16-18H,12-15H2,1H3,(H2,29,30,33,36) |
| InChIKey | MEENBAWDPWQJBA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|