C25H27N3O4S — CID 17415944
N-(2,2-diphenylethyl)-2-morpholin-4-yl-5-sulfamoylbenzamide (PubChem CID 17415944) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-2-morpholin-4-yl-5-sulfamoylbenzamide.
| Compound Name | N-(2,2-diphenylethyl)-2-morpholin-4-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 17415944 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-(2,2-diphenylethyl)-2-morpholin-4-yl-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H27N3O4S/c26-33(30,31)21-11-12-24(28-13-15-32-16-14-28)22(17-21)25(29)27-18-23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,23H,13-16,18H2,(H,27,29)(H2,26,30,31) |
| InChIKey | ZWSHLVGUVVWEQC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |