C21H29N3O3S2 — CID 134014499
5-(dimethylsulfamoyl)-N-ethyl-2-piperidin-1-yl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 134014499) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-ethyl-2-piperidin-1-yl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-ethyl-2-piperidin-1-yl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 134014499 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-ethyl-2-piperidin-1-yl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CCN(Cc1cccs1)C(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCCCC1 |
| InChI | InChI=1S/C21H29N3O3S2/c1-4-23(16-17-9-8-14-28-17)21(25)19-15-18(29(26,27)22(2)3)10-11-20(19)24-12-6-5-7-13-24/h8-11,14-15H,4-7,12-13,16H2,1-3H3 |
| InChIKey | GCVUIBHUXGNCMF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |