C17H16F2N2O5S — CID 8563364
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8563364) has the molecular formula C17H16F2N2O5S and a molecular weight of 398.39 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8563364 |
| Molecular Formula | C17H16F2N2O5S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C17H16F2N2O5S/c1-21(9-11-4-2-3-5-14(11)18)16(22)10-26-17(23)13-8-12(27(20,24)25)6-7-15(13)19/h2-8H,9-10H2,1H3,(H2,20,24,25) |
| InChIKey | FKXGKAMYUXPNRI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |