C16H14ClFN2O3 — CID 55459905
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-4-carboxylate (PubChem CID 55459905) has the molecular formula C16H14ClFN2O3 and a molecular weight of 336.75 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-4-carboxylate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 55459905 |
| Molecular Formula | C16H14ClFN2O3 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-4-carboxylate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2O3/c1-20(9-12-4-2-3-5-13(12)18)15(21)10-23-16(22)11-6-7-19-14(17)8-11/h2-8H,9-10H2,1H3 |
| InChIKey | JGKIORAVNPFGJA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|