C16H13Cl2FN2O3 — CID 55313861
[2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 55313861) has the molecular formula C16H13Cl2FN2O3 and a molecular weight of 371.20 g/mol. Its IUPAC name is [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 55313861 |
| Molecular Formula | C16H13Cl2FN2O3 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)COC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H13Cl2FN2O3/c1-21(8-11-12(17)3-2-4-13(11)19)15(22)9-24-16(23)10-5-6-14(18)20-7-10/h2-7H,8-9H2,1H3 |
| InChIKey | DWXKPHAWEWOGAE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|