C20H19ClFNO4 — CID 55325082
[2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-phenylbutanoate (PubChem CID 55325082) has the molecular formula C20H19ClFNO4 and a molecular weight of 391.83 g/mol. Its IUPAC name is [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-phenylbutanoate.
| Compound Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 55325082 |
| Molecular Formula | C20H19ClFNO4 |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-4-phenylbutanoate |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)COC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19ClFNO4/c1-23(12-15-16(21)8-5-9-17(15)22)19(25)13-27-20(26)11-10-18(24)14-6-3-2-4-7-14/h2-9H,10-13H2,1H3 |
| InChIKey | NOTZDUSODABZSA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |