C20H17FN2O3 — CID 55562613
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] quinoline-5-carboxylate (PubChem CID 55562613) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] quinoline-5-carboxylate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] quinoline-5-carboxylate |
|---|---|
| PubChem CID | 55562613 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] quinoline-5-carboxylate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C20H17FN2O3/c1-23(12-14-6-2-3-9-17(14)21)19(24)13-26-20(25)16-7-4-10-18-15(16)8-5-11-22-18/h2-11H,12-13H2,1H3 |
| InChIKey | FSQADJPBRQFJPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |