C15H17NO4S2 — CID 51174659
N-methyl-2-(4-methylsulfonylphenoxy)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 51174659) has the molecular formula C15H17NO4S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-methyl-2-(4-methylsulfonylphenoxy)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-methyl-2-(4-methylsulfonylphenoxy)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51174659 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-methyl-2-(4-methylsulfonylphenoxy)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN(Cc1cccs1)C(=O)COc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H17NO4S2/c1-16(10-13-4-3-9-21-13)15(17)11-20-12-5-7-14(8-6-12)22(2,18)19/h3-9H,10-11H2,1-2H3 |
| InChIKey | REVAGSQTXMBWJN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |