C18H18BrFN2O3S — CID 56552612
N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56552612) has the molecular formula C18H18BrFN2O3S and a molecular weight of 441.32 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56552612 |
| Molecular Formula | C18H18BrFN2O3S |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-(4-sulfamoylphenyl)acetamide |
| SMILES | C=CCN(Cc1cc(Br)ccc1F)C(=O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H18BrFN2O3S/c1-2-9-22(12-14-11-15(19)5-8-17(14)20)18(23)10-13-3-6-16(7-4-13)26(21,24)25/h2-8,11H,1,9-10,12H2,(H2,21,24,25) |
| InChIKey | MGCDUHPOPZIMRZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|