C16H20BrFN2OS — CID 119938340
N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-thiomorpholin-3-ylacetamide (PubChem CID 119938340) has the molecular formula C16H20BrFN2OS and a molecular weight of 387.32 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119938340 |
| Molecular Formula | C16H20BrFN2OS |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enyl-2-thiomorpholin-3-ylacetamide |
| SMILES | C=CCN(Cc1cc(Br)ccc1F)C(=O)CC1CSCCN1 |
| InChI | InChI=1S/C16H20BrFN2OS/c1-2-6-20(10-12-8-13(17)3-4-15(12)18)16(21)9-14-11-22-7-5-19-14/h2-4,8,14,19H,1,5-7,9-11H2 |
| InChIKey | UZPLOGUOSPVFQH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|