C17H22BrFN2O — CID 120629500
(2S,4S)-N-[(5-bromo-2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 120629500) has the molecular formula C17H22BrFN2O and a molecular weight of 369.28 g/mol. Its IUPAC name is (2S,4S)-N-[(5-bromo-2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[(5-bromo-2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120629500 |
| Molecular Formula | C17H22BrFN2O |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (2S,4S)-N-[(5-bromo-2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCN(Cc1cc(Br)ccc1F)C(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C17H22BrFN2O/c1-3-8-21(11-14-10-15(18)4-5-16(14)19)17(22)13-6-7-20-12(2)9-13/h3-5,10,12-13,20H,1,6-9,11H2,2H3/t12-,13-/m0/s1 |
| InChIKey | ORWSHYPEAQVVNL-STQMWFEESA-N |
| XLogP | 3.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|