C17H22BrFN2O — CID 119764011
3-amino-N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide (PubChem CID 119764011) has the molecular formula C17H22BrFN2O and a molecular weight of 369.28 g/mol. Its IUPAC name is 3-amino-N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119764011 |
| Molecular Formula | C17H22BrFN2O |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-amino-N-[(5-bromo-2-fluorophenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide |
| SMILES | C=CCN(Cc1cc(Br)ccc1F)C(=O)C1CCCC(N)C1 |
| InChI | InChI=1S/C17H22BrFN2O/c1-2-8-21(11-13-9-14(18)6-7-16(13)19)17(22)12-4-3-5-15(20)10-12/h2,6-7,9,12,15H,1,3-5,8,10-11,20H2 |
| InChIKey | FPRXXMSSZDGQQN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|