C18H26N2O2 — CID 131912242
cis-(1R,3S)-3-amino-N-[(2-methoxyphenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide (PubChem CID 131912242) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is cis-(1R,3S)-3-amino-N-[(2-methoxyphenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-amino-N-[(2-methoxyphenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 131912242 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | cis-(1R,3S)-3-amino-N-[(2-methoxyphenyl)methyl]-N-prop-2-enylcyclohexane-1-carboxamide |
| SMILES | C=CCN(Cc1ccccc1OC)C(=O)[C@@H]1CCC[C@H](N)C1 |
| InChI | InChI=1S/C18H26N2O2/c1-3-11-20(13-15-7-4-5-10-17(15)22-2)18(21)14-8-6-9-16(19)12-14/h3-5,7,10,14,16H,1,6,8-9,11-13,19H2,2H3/t14-,16+/m1/s1 |
| InChIKey | GTUCBEMGZGDJHK-ZBFHGGJFSA-N |
| XLogP | 2.73 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|