C13H15BrFNO — CID 116568928
(3-aminocyclohexyl)-(5-bromo-2-fluorophenyl)methanone (PubChem CID 116568928) has the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. Its IUPAC name is (3-aminocyclohexyl)-(5-bromo-2-fluorophenyl)methanone.
| Compound Name | (3-aminocyclohexyl)-(5-bromo-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 116568928 |
| Molecular Formula | C13H15BrFNO |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (3-aminocyclohexyl)-(5-bromo-2-fluorophenyl)methanone |
| SMILES | NC1CCCC(C(=O)c2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C13H15BrFNO/c14-9-4-5-12(15)11(7-9)13(17)8-2-1-3-10(16)6-8/h4-5,7-8,10H,1-3,6,16H2 |
| InChIKey | DPGYCJRHGIIGFW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |