C15H18BrFN2O — CID 43596086
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-bromo-2-fluorophenyl)methanone (PubChem CID 43596086) has the molecular formula C15H18BrFN2O and a molecular weight of 341.22 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-bromo-2-fluorophenyl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-bromo-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 43596086 |
| Molecular Formula | C15H18BrFN2O |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(5-bromo-2-fluorophenyl)methanone |
| SMILES | NC1CC[C@@H]2CN(C(=O)c3cc(Br)ccc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C15H18BrFN2O/c16-11-2-4-14(17)13(6-11)15(20)19-7-9-1-3-12(18)5-10(9)8-19/h2,4,6,9-10,12H,1,3,5,7-8,18H2/t9-,10+,12?/m1/s1 |
| InChIKey | RPGKSOYHTQXWGY-WFCWDVHWSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |