C13H16Br2N2OS — CID 107963486
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 107963486) has the molecular formula C13H16Br2N2OS and a molecular weight of 408.16 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 107963486 |
| Molecular Formula | C13H16Br2N2OS |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | NC1CC[C@@H]2CN(C(=O)c3cc(Br)sc3Br)C[C@@H]2C1 |
| InChI | InChI=1S/C13H16Br2N2OS/c14-11-4-10(12(15)19-11)13(18)17-5-7-1-2-9(16)3-8(7)6-17/h4,7-9H,1-3,5-6,16H2/t7-,8+,9?/m1/s1 |
| InChIKey | QFIQOJLHIBTZIX-WGTSGOJVSA-N |
| XLogP | 3.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |