C11H13Br2ClN2OS — CID 120656350
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dibromothiophen-3-yl)methanone;hydrochloride (PubChem CID 120656350) has the molecular formula C11H13Br2ClN2OS and a molecular weight of 416.57 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dibromothiophen-3-yl)methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dibromothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120656350 |
| Molecular Formula | C11H13Br2ClN2OS |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 413.88 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dibromothiophen-3-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(Br)sc1Br)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C11H12Br2N2OS.ClH/c12-9-1-8(10(13)17-9)11(16)15-4-6-2-14-3-7(6)5-15;/h1,6-7,14H,2-5H2;1H/t6-,7+; |
| InChIKey | WJKWLQRZUOSDII-UKMDXRBESA-N |
| XLogP | 2.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |