C17H18BrClN2OS — CID 120656367
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-bromophenyl)thiophen-2-yl]methanone;hydrochloride (PubChem CID 120656367) has the molecular formula C17H18BrClN2OS and a molecular weight of 413.77 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-bromophenyl)thiophen-2-yl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-bromophenyl)thiophen-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120656367 |
| Molecular Formula | C17H18BrClN2OS |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(4-bromophenyl)thiophen-2-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(-c2ccc(Br)cc2)s1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C17H17BrN2OS.ClH/c18-14-3-1-11(2-4-14)15-5-6-16(22-15)17(21)20-9-12-7-19-8-13(12)10-20;/h1-6,12-13,19H,7-10H2;1H/t12-,13+; |
| InChIKey | MJVOZUZXPDYWBY-OEEJBDNKSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |