C16H19BrFN3O2 — CID 167820044
1-[(5-bromo-2-fluorophenyl)methyl]-3-(2-oxopiperidin-4-yl)-1-prop-2-enylurea (PubChem CID 167820044) has the molecular formula C16H19BrFN3O2 and a molecular weight of 384.25 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl]-3-(2-oxopiperidin-4-yl)-1-prop-2-enylurea.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-(2-oxopiperidin-4-yl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 167820044 |
| Molecular Formula | C16H19BrFN3O2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-(2-oxopiperidin-4-yl)-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cc(Br)ccc1F)C(=O)NC1CCNC(=O)C1 |
| InChI | InChI=1S/C16H19BrFN3O2/c1-2-7-21(10-11-8-12(17)3-4-14(11)18)16(23)20-13-5-6-19-15(22)9-13/h2-4,8,13H,1,5-7,9-10H2,(H,19,22)(H,20,23) |
| InChIKey | XZTSMYRHFKHDTF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|