C21H22BrFN2O3S — CID 76879026
N-[(5-bromo-2-fluorophenyl)methyl]-3-[4-(dimethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide (PubChem CID 76879026) has the molecular formula C21H22BrFN2O3S and a molecular weight of 481.39 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-[4-(dimethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-[4-(dimethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 76879026 |
| Molecular Formula | C21H22BrFN2O3S |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-[4-(dimethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(Cc1cc(Br)ccc1F)C(=O)C=Cc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H22BrFN2O3S/c1-4-13-25(15-17-14-18(22)8-11-20(17)23)21(26)12-7-16-5-9-19(10-6-16)29(27,28)24(2)3/h4-12,14H,1,13,15H2,2-3H3 |
| InChIKey | AUFKLHBWVOPJRC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|