C23H23FN2O2 — CID 98883480
N-cyclopropyl-4-[(E)-3-[(2-fluorophenyl)methyl-prop-2-enylamino]-3-oxoprop-1-enyl]benzamide (PubChem CID 98883480) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[(2-fluorophenyl)methyl-prop-2-enylamino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[(2-fluorophenyl)methyl-prop-2-enylamino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 98883480 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[(2-fluorophenyl)methyl-prop-2-enylamino]-3-oxoprop-1-enyl]benzamide |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)/C=C/c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C23H23FN2O2/c1-2-15-26(16-19-5-3-4-6-21(19)24)22(27)14-9-17-7-10-18(11-8-17)23(28)25-20-12-13-20/h2-11,14,20H,1,12-13,15-16H2,(H,25,28)/b14-9+ |
| InChIKey | LCNIPGRDKDTZDQ-NTEUORMPSA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|