C18H22N2O3S — CID 32895401
N-[(2,4-dimethylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide (PubChem CID 32895401) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 32895401 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2cc(S(N)(=O)=O)ccc2C)c(C)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-12-5-7-15(14(3)9-12)11-20(4)18(21)17-10-16(24(19,22)23)8-6-13(17)2/h5-10H,11H2,1-4H3,(H2,19,22,23) |
| InChIKey | MULMUFNHEDMNFL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |